Borate fluoride
The borate fluorides or fluoroborates are compounds containing borate or complex borate ions along with fluoride ions that form salts with cations such as metals. They are in the broader category of mixed anion compounds. They are not to be confused with tetrafluoroborates (BF4) or the fluorooxoborates which have fluorine bonded to boron.
Examples
| formula | name | mw | system | space group | unit cell Å | volume Å3 | density | comment | references |
|---|---|---|---|---|---|---|---|---|---|
| Be2(BO3)(OH,F) · H2O | Berborite | trigonal | P3 | a = 4.434, c = 5.334 | 90.82 | colourless
Uniaxial (-) nω = 1.580 nε = 1.485 Max birefringence δ = 0.095 |
|||
| γ‐Be2BO3F | γ‐BBF | 95.83 | trigonal | R32 | a=4.4418 c=19.909 Z=3 | 340.17 | 1.946 | Uniaxial (-) SHG 2.3 × KDP | |
| NH4Be2BO3F2 | ABBF | 132.87 | trigonal | R32 | a=4.4398 c=12.4697 Z=3 | 212.87 | 2.243 | Uniaxial (-) no=1.49389 ne=1.41919 at 636 nm | [2] |
| NaBe2BO3F2 | sodium beryllium borate fluoride (NBBF) | C2 | a=12.643 b=8.729 c=7.591 β=113.6° | 768 | double layers of borate rings sandwiching barium atoms. Between pairs of double layers are sodium ions with fluoride. | [3] | |||
| Mg2(BO3)(F,OH) | Pertsevite-(F) | orthorhombic | Pna21 | a = 20.49, b = 4.571, c = 11.89 Z=16 | 1,113.6 | Density 3.12
transparent Biaxial (+) nα = 1.609 nβ = 1.620 nγ = 1.642 2V: 65° Max birefringence: δ = 0.033 |
[4] | ||
| Mg3(BO3)(F,OH)3 | Fluoborite | hexagonal | a = 8.8, c = 3.1 | 208 | colourless
Uniaxial (-) nω = 1.570 nε = 1.534 Max birefringence δ = 0.036 |
[5] | |||
| Mg3(OH)[B(OH)4]2(SO4)F | sulfoborite | orthorhombic | Pnma | a=10.132 b=12.537 c=7.775 | 987.6 | Biaxial (-) nα = 1.527 nβ = 1.536 nγ = 1.551
2V 79° Max birefringence δ = 0.024 |
[6] | ||
| Al6(BO3)5F3 |
hexagonal |
P63/m |
a = 8.5591, c = 8.1814 |
519 |
density 3.28 Uniaxial (-) nω = 1.653 nε = 1.640 Max birefringence δ = 0.013 |
[7][8] | |||
| Al8(BO3)4(B2O5)F8 | 704.7 | tetragonal | P42/mmc | a=9.134 c=19.112 Z=4 | 1,595 | density 2.935 colourless | [7] | ||
| Na(Mg3)Al6(Si6O18)(BO3)3(OH)3F | Fluor-dravite | trigonal | R3m | a = 15.955, c = 7.153 Z=3 | 1,577 | density 3.120
dark brown Uniaxial (-) nω = 1.645(2) nε = 1.621(2) Max birefringence δ = 0.024 |
[9] | ||
| Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F | Fluor-elbaite | trigonal | R3m | a = 15.8933, c = 7.1222 | 1,558 | blue green
Uniaxial (-) |
[10] | ||
| K6B12O19F4 | 744.32 | orthorhombic | Pnma | a =15.291 b =7.707 c =8.672 Z=2 | 1022.0 | 2.419 | [11] | ||
| KBe2BO3F2 | KBBF | hexagonal | R32 | a=4.427 c=18.744 | 318.3 | 2.40 | Be2BO6F2 rings SHG 1.2 × KDP; UV cutoff 147 nm | [12] | |
| Li3CaB2O5F | 363.04 | orthorhombic | Pnma | a=25.685 b=3.4697 c=5.4404 Z=2 | 484.84 | 2.487 | colourless | [13] | |
| NaCaBe2B2O6F | |||||||||
| Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F | Fluor-liddicoatite | trigonal | R3m | a = 15.875, c = 7.126 Z=3 | 1,555 | density 3.02
Uniaxial (-) nω = 1.637 nε = 1.621 Max birefringence δ = 0.016 |
[14] | ||
| CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F | Fluor-uvite | trigonal | R3m | a = 15.954, c = 7.214 Z=3 | 1,590 | black
Uniaxial nω = 1.637 - 1.668 nε = 1.619 - 1.639 Max birefringence δ = 0.018 - 0.029 |
[15] | ||
| KCaBe2B2O6F | |||||||||
| Sc2F2(B2O5) | 229.54 | orthorhombic | Pbam | a=9.667 b=14.199 c=4.0395 Z=4 | 554.4 | 2.750 | colourless | [16] | |
| Na(Mn2+)3Al6(Si6O18)(BO3)3(OH)3F | Fluor-tsilaisite | trigonal | R3m | a = 15.9398, c = 7.1363 | 1,570 | greenish yellow
Uniaxial (-) |
[17] | ||
| NaFe3Al6Si6B3O30F | [7] | ||||||||
| Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3F | Fluor-schorl | trigonal | R3m | a = 16.005, c = 7.176 Z=3 | 1,591.9 | black
Uniaxial (-) nω = 1.660 - 1.661 nε = 1.636 - 1.637 Max birefringence δ = 0.024 |
[18] | ||
| Na(Fe3+3)Al6(Si6O18)(BO3)3O3F | Fluor-buergerite | trigonal | R3m | a = 15.8692, c = 7.1882 | 1,568 | density 3.311
brown Uniaxial (-) nω = 1.735 nε = 1.655 Birefringence 0.080 |
[19] | ||
| Ca(Fe2+)3MgAl5(Si6O18)(BO3)3(OH)3F | Fluor-feruvite | [20] | |||||||
| RbBe2BO3F2 | RBBF | Trigonal | R32 | a=4.434 c=19.758 z=3 | also contains BeO3F tetrahedra and BO3. It transmits radiation from 180 to 3500 nm. | [21] | |||
| Rb18Mg6(B5O10)3(B7O14)2F | monoclinic | C2/c | a=11.06 b=19.70 c=31.01 β=90.13° | [22] | |||||
| KSrBe2B2O6F | |||||||||
| LiSr3Be3B3O9F4 | |||||||||
| NaSr3Be3B3O9F4 | |||||||||
| K3Sr3Li2Al4B6O20F | SHG 4 × KDP; 170 nm UV cutoff | [7] | |||||||
| Ca(Y,REE,Ca,Na,Mn)15Fe2+(P,Si)Si6B3O34F14 | Proshchenkoite-(Y) | trigonal | R3m | a = 10.7527, c = 27.4002 | 2,743.6 | brownish | [23] | ||
| (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1−x)(Si,As5+)Si6B3(O,F)48 | Hundholmenite-(Y) | trigonal | R3m | a = 10.675, c = 27.02 Z=3 | 2,667 | density 5.206
brownish Uniaxial (-) |
[24] | ||
| (Na,Ca)3(Y,Ce)12Si6B2O27F14 | Okanoganite-(Y) | trigonal | R3m | a = 10.7108, c = 27.040 | 4.35 | Tan coloured
Uniaxial (-) nω = 1.753 nε = 1.740 Max birefringence δ = 0.013 |
[25] | ||
| ? Y5(SiO4,BO4)3(O,OH,F) | Tritomite-(Y) | ?hexagonal | a = 9.32, c = 6.84 | 3.05-3.4 | isotropic
n = 1.627 - 1.685 |
||||
| Cd8B5O15F | 1212.25 | cubic | Fd3m | a = 13.972 Z = 8 | 2,727 | 5.904 | colourless | [26] | |
| Li3Cs6Al2B14O28F | 1490.58 | orthorhombic | Pnma | a=21.8412 b=19.8875 c=7.1577 Z=4 | 3109.1 | 3.184 | [27] | ||
| Cs18Mg6(B5O10)3(B7O14)2F | monoclinic | C2/c | a=11.234 b=20.11 c=32.12 β=90.225° | [22] | |||||
| BaBOF3 | 221.15 | monoclinic | P21/c | a = 4.620 b = 15.186 c = 4.426 β = 92.045° Z=4 | 310.3 | contains chains of -OB(F2)- and a double chain of BaF | [28] | ||
| BaMgBe2(BO3)2F2 | BMBBF | 335.283 | trigonal | P3c1 | a=4.5898 c=15.348 | 280.01 | 3.976 | colourless [Be2B3O6F2]∞ | [29] |
| BaCaBe2(BO3)2F2 | BCBBF | trigonal | P3c1 | a=4.6931 c=16.049 | 306.12 | 3.808 | colourless [Be2B3O6F2]∞ | [29] | |
| BaBe2BO3F3 | |||||||||
| BaAl(BO3)F2 | UV cutoff 165 nm | ||||||||
| K3Ba3Li2Al4B6O20F | [7] | ||||||||
| K5Ba10(BO3)8F | trigonal | R3c | a = 15.293, c = 22.699 Z = 6 | [30] | |||||
| KBa7Mg2B14O28F5 | monoclinic | C2/c | a = 16.638 b = 13.609 c = 15.214 β = 121.309° Z=4 | 2943.3 | 3.934 | colourless | [31] | ||
| Li2BaSc(BO3)2F | hexagonal | P63/m | a=4.895 c=14.346 | [32] | |||||
| Ba3Zn(BO3)(B2O5)F | 656.82 | monoclinic | P21/c | a = 15.179 b = 7.0064 c = 8.763 β = 100.15° Z=4 | 917.4 | 4.755 | colourless | [33] | |
| Ba4Zn2(BO3)2(B2O5)F2 | 937.34 | monoclinic | C2/c | a=20.39 b=4.998 c=13.068 β = 192.59 Z=44 | 1,331 | 4.679 | colourless | [33] | |
| BaZnBe2(BO3)2F2 | 376.35 | trigonal | P3 | a = 4.5998, c = 7.7037 Z = 1 | 141.16 | 4.427 | colourless | [34] | |
| Rb3Ba3Li2Al4B6O20F | [7] | ||||||||
| Ba1.09Pb0.91Be2(BO3)2F2 | BPBBF | trigonal | P3m1 | a = 4.7478 c = 8.386, Z = 1 | 163.70 | UV absorption edge=279.1 nm; birefringence 0.054 at 546.1 nm; 2D [Be3B3O6F3]∞ layer | [35] | ||
| LiBa2Pb(BO3)2F | orthorhombic | Pmmn | a=5.487 b=15.96 c=4.034 | [32] | |||||
| KNa3Na6Ca2Ba6Mn6(Ti4+,Nb)6B12Si36O114(O,OH,F)11 | Tienshanite | hexagonal | P6/m | a = 16.785, c = 10.454 Z=1 | 2,551 | pale olive green
Uniaxial (-) nω = 1.666 nε = 1.653 Max birefringence δ = 0.013 |
[36] | ||
| Ca6(Fe2+,Mn2+)Y3REE7(SiO4)3(PO4)(B3Si3O18)(BO3)F11 | Laptevite-(Ce) | trigonal | R3m | a = 10.804, c = 27.726 Z=3 | 2,803 | density 4.61
dark brown Uniaxial (-) nω = 1.741(3) nε = 1.720(3) Max birefringence δ = 0.021 |
[37] | ||
| Ba(Y,Ce)6Si3B6O24F2 | Cappelenite-(Y) | trigonal | P3 | a = 10.67, c = 4.68 Z=1 | 461 | 4.407 | greenish brown | [38] | |
| CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 | Arrheniusite-(Ce) | trigonal | R3m | a = 10.8082, c = 27.5196 | [39] | ||||
| (Ca,Ce,La,Th)15As5+(As3+0.5,Na0.5)Fe3+Si6B4O40F7 | Vicanite-(Ce) | trigonal | R3m | a=10.881 c=27.33 | 2,766 | 4.82 | greenish yellow
Uniaxial (-) nω = 1.757 nε = 1.722 Max birefringence δ = 0.035 |
[40] |
References
- "Berborite". www.mindat.org. Retrieved 2020-12-15.
- Peng, Guang; Ye, Ning; Lin, Zheshuai; Kang, Lei; Pan, Shilie; Zhang, Min; Lin, Chensheng; Long, Xifa; Luo, Min; Chen, Yu; Tang, Yu-Huan (2018-07-16). "NH 4 Be 2 BO 3 F 2 and γ-Be 2 BO 3 F: Overcoming the Layering Habit in KBe 2 BO 3 F 2 for the Next-Generation Deep-Ultraviolet Nonlinear Optical Materials". Angewandte Chemie. 130 (29): 9106–9110. Bibcode:2018AngCh.130.9106P. doi:10.1002/ange.201803721. S2CID 242082788.
- Mei, Linfeng; Wang, Yebin; Chen, Chunagtian (January 1994). "Crystal structure of sodium beryllium borate fluoride". Materials Research Bulletin. 29 (1): 81–87. doi:10.1016/0025-5408(94)90108-2.
- "Pertsevite-(F)". www.mindat.org. Retrieved 2020-12-14.
- "Fluoborite". www.mindat.org. Retrieved 2020-12-14.
- "Sulfoborite". www.mindat.org. Retrieved 2020-12-15.
- Wang, Ya; Han, Jian; Huang, Junben; Yang, Zhihua; Pan, Shilie (2020-01-06). "Al 8 (BO 3 ) 4 (B 2 O 5 )F 8 : A F-Containing Aluminum Borate Featuring Two Types of Isolated B–O Groups". Inorganic Chemistry. 59 (1): 810–817. doi:10.1021/acs.inorgchem.9b03067. ISSN 0020-1669. PMID 31877030. S2CID 209489879.
- "Jeremejevite". www.mindat.org. Retrieved 2020-12-14.
- "Fluor-dravite". www.mindat.org. Retrieved 2020-12-15.
- "Fluor-elbaite". www.mindat.org. Retrieved 2020-12-15.
- Huang, Shuzhao; Zhu, Liang; Kruglov, Ivan; Yang, Yun; Yang, Zhihua; Pan, Shilie (2023-05-09). "Two Ultraviolet Optical Crystals K 6 B 12 O 19 F 4 and K 12 B 28 O 48 : The Effects of Metal Cations Size and the F Ions on the Structure". Inorganic Chemistry: acs.inorgchem.3c00519. doi:10.1021/acs.inorgchem.3c00519. ISSN 0020-1669.
- Mei, L.; Huang, X.; Wang, Y.; Wu, Q.; Wu, B.; Chen, C. (January 1995). "Crystal structure of KBe 2 BO 3 F 2". Zeitschrift für Kristallographie. 210 (2): 93–95. Bibcode:1995ZK....210...93M. doi:10.1524/zkri.1995.210.2.93. ISSN 0044-2968.
- Ding, Mengmeng; Xu, JingJing; Wu, Hongping; Yu, Hongwei; Hu, Zhanggui; Wang, Jiyang; Wu, Yicheng (2020). "Li 3 CaB 2 O 5 F: a unique sandwich-like structure with diverse and wide Li ion diffusion pathways". Dalton Transactions. 49 (35): 12184–12188. doi:10.1039/D0DT02423F. ISSN 1477-9226. PMID 32930685. S2CID 221723666.
- "Fluor-liddicoatite". www.mindat.org. Retrieved 2020-12-15.
- "Fluor-uvite". www.mindat.org. Retrieved 2020-12-15.
- Tang, Ru-Ling; Xu, Wei; Xie, Wei-Jie; Hu, Chun-Li (2022). "Sc 2 F 2 (B 2 O 5 ): a deep ultraviolet scandium borate fluoride exhibiting large birefringence induced by the synergistic effect of B 2 O 5 and ScO n F 2 groups". Inorganic Chemistry Frontiers. 9 (20): 5153–5160. doi:10.1039/D2QI01484J. ISSN 2052-1553. S2CID 251431496.
- "Fluor-tsilaisite". www.mindat.org. Retrieved 2020-12-15.
- "Fluor-schorl". www.mindat.org. Retrieved 2020-12-15.
- "Fluor-buergerite". www.mindat.org. Retrieved 2020-12-15.
- "Fluor-feruvite". www.mindat.org. Retrieved 2020-12-15.
- Chen, Chuangtian; Luo, Siyang; Wang, Xiaoyang; Wang, Guiling; Wen, Xiaohong; Wu, Huaxing; Zhang, Xin; Xu, Zuyan (8 July 2009). "Deep UV nonlinear optical crystal:RbBe_2(BO_3)F_2". Journal of the Optical Society of America B. 26 (8): 1519. Bibcode:2009JOSAB..26.1519C. doi:10.1364/JOSAB.26.001519.
- Wang, Zheng; Zhang, Min; Su, Xin; Pan, Shilie; Yang, Zhihua; Zhang, Hui; Liu, Lu (2015-01-19). "Q 18 Mg 6 (B 5 O 10 ) 3 (B 7 O 14 ) 2 F (Q=Rb and Cs): New Borates Containing Two Large Isolated Polyborate Anions with Similar Topological Structures". Chemistry - A European Journal. 21 (4): 1414–1419. doi:10.1002/chem.201404738. PMID 25414057.
- "Proshchenkoite-(Y)". www.mindat.org. Retrieved 2020-12-14.
- "Hundholmenite-(Y)". www.mindat.org. Retrieved 2020-12-14.
- "Okanoganite-(Y)". www.mindat.org. Retrieved 2020-12-14.
- Yang, Yun; Dong, Xiaoyu; Pan, Shilie (2016). "New fluoroborate Cd 8 B 5 O 15 F with two different isolated borate anions prepared by an open high-temperature solution method". Dalton Transactions. 45 (16): 7008–7013. doi:10.1039/C6DT00621C. ISSN 1477-9226. PMID 26988597.
- Li, Xingqi; Chu, Dongdong; Jin, Wenqi; Yang, Zhihua; Pan, Shilie; Mutailipu, Miriding (2022-08-08). "Rearrangement of [B 2 O 5 ] Dimers within [B 7 O 14 ] Clusters Enables Enhanced Optical Anisotropy in Li 3 Cs 6 Al 2 B 14 O 28 F". Inorganic Chemistry. 61 (31): 12067–12072. doi:10.1021/acs.inorgchem.2c02347. ISSN 0020-1669. PMID 35894746. S2CID 251102413.
- Jiang, Dequan; Wang, Ying; Li, Hao; Yang, Zhihua; Pan, Shilie (2018). "BaBOF3 : a new aurivillius-like borate containing two types of F atoms". Dalton Transactions. 47 (15): 5157–5160. doi:10.1039/C8DT00403J. PMID 29557465.
- Guo, Shu; Jiang, Xingxing; Xia, Mingjun; Liu, Lijuan; Fang, Zhi; Huang, Qian; Wu, Ruofei; Wang, Xiaoyang; Lin, Zheshuai; Chen, Chuangtian (2017-10-02). "Structural Design of Two Fluorine–Beryllium Borates BaMBe2(BO3)2F2 (M = Mg, Ca) Containing Flexible Two-Dimensional [Be3B3O6F3]∞ Single Layers without Structural Instability Problems". Inorganic Chemistry. 56 (19): 11451–11454. doi:10.1021/acs.inorgchem.7b01627. ISSN 0020-1669. PMID 28885824.
- Liu, Lili; Yang, Yun; Jing, Qun; Dong, Xiaoyu; Yang, Zhihua; Pan, Shilie; Wu, Kui (2016-08-25). "K 5 Ba 10 (BO 3 ) 8 F: A New Potassium Barium Borate Fluoride with a Perovskite-Like Structure". The Journal of Physical Chemistry C. 120 (33): 18763–18770. doi:10.1021/acs.jpcc.6b05489. ISSN 1932-7447.
- Li, R. K.; Chen, Peng (2010-01-15). "KBa 7 Mg 2 B 14 O 28 F 5 , a new borate with an unusual heptaborate group and double perovskite unit". Acta Crystallographica Section C Crystal Structure Communications. 66 (1): i7–i8. doi:10.1107/S0108270109054341. ISSN 0108-2701. PMID 20048410.
- Chen, Yanna; Zhang, Min; Hu, Cong; Wu, Hongping; Yang, Zhihua; Pan, Shilie (2018-10-17). "Li 2 BaSc(BO 3 ) 2 F and LiBa 2 Pb(BO 3 ) 2 F with Layered Structures featuring Special Li−O/F Configurations". Chemistry – A European Journal. 24 (58): 15477–15481. doi:10.1002/chem.201804126. ISSN 0947-6539. PMID 30230058. S2CID 52294586.
- Mutailipu, Miriding; Su, Xin; Zhang, Min; Yang, Zhihua; Pan, Shilie (2017). "Ba n+2 Zn n (BO 3 ) n (B 2 O 5 )F n (n = 1, 2): new members of the zincoborate fluoride series with two kinds of isolated B–O units". Inorganic Chemistry Frontiers. 4 (2): 281–288. doi:10.1039/C6QI00467A. ISSN 2052-1553.
- Guo, Ruixin; Liu, Xiaomeng; Tao, Ce; Tang, Changcheng; Xia, Mingjun; Liu, Lijuan; Lin, Zheshuai; Wang, Xiaoyang (2021). "BaZnBe 2 (BO 3 ) 2 F 2 : a novel zinc-beryllium borate with SBBO-type structure overcoming the polymorphism problem". Dalton Transactions. 50 (6): 2138–2142. doi:10.1039/D0DT04153J. ISSN 1477-9226. PMID 33491694. S2CID 231701941.
- Guo, Ruixin; Guo, Shu; Xia, Mingjun; Liu, Lijuan; Li, Minjuan; Zhao, Sangen; Wang, Xiaoyang (2023-02-20). "Ba 1.09 Pb 0.91 Be 2 (BO 3 ) 2 F 2 : The First Pb-Containing Beryllium Borate Fluoride with Trigonal Prismatic PbO 6 and 2D [Be 3 B 3 O 6 F 3 ] ∞ Layers". Inorganic Chemistry. 62 (9): 3860–3865. doi:10.1021/acs.inorgchem.2c04122. ISSN 0020-1669. PMID 36802565. S2CID 257067883.
- "Tienshanite". www.mindat.org. Retrieved 2020-12-14.
- "Laptevite-(Ce)". www.mindat.org. Retrieved 2020-12-14.
- "Cappelenite-(Y)". www.mindat.org. Retrieved 2020-12-14.
- "Arrheniusite-(Ce)". www.mindat.org. Retrieved 2020-12-14.
- "Vicanite-(Ce)". www.mindat.org. Retrieved 2020-12-14.